C25H32FN3O4 — CID 55958908
benzyl N-[4-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-4-oxobutyl]carbamate (PubChem CID 55958908) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is benzyl N-[4-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55958908 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | benzyl N-[4-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-4-oxobutyl]carbamate |
| SMILES | COc1ccc(CN2CCC(NC(=O)CCCNC(=O)OCc3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C25H32FN3O4/c1-32-23-10-9-20(16-22(23)26)17-29-14-11-21(12-15-29)28-24(30)8-5-13-27-25(31)33-18-19-6-3-2-4-7-19/h2-4,6-7,9-10,16,21H,5,8,11-15,17-18H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | DKUWWOHJIRRPOT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|