C27H28FN3O3 — CID 55959028
2-benzamido-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 55959028) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-benzamido-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 2-benzamido-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55959028 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-benzamido-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | COc1ccc(CN2CCC(NC(=O)c3ccccc3NC(=O)c3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C27H28FN3O3/c1-34-25-12-11-19(17-23(25)28)18-31-15-13-21(14-16-31)29-27(33)22-9-5-6-10-24(22)30-26(32)20-7-3-2-4-8-20/h2-12,17,21H,13-16,18H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | RPNOXQSRWASCMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |