C20H24FN3O3 — CID 55909424
4-acetyl-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 55909424) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-acetyl-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55909424 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-acetyl-N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | COc1ccc(CN2CCC(NC(=O)c3cc(C(C)=O)c[nH]3)CC2)cc1F |
| InChI | InChI=1S/C20H24FN3O3/c1-13(25)15-10-18(22-11-15)20(26)23-16-5-7-24(8-6-16)12-14-3-4-19(27-2)17(21)9-14/h3-4,9-11,16,22H,5-8,12H2,1-2H3,(H,23,26) |
| InChIKey | SECNGAZDFZQPCN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |