C24H27FN4O2 — CID 55957745
N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(5-methylpyrazol-1-yl)benzamide (PubChem CID 55957745) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(5-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(5-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55957745 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(5-methylpyrazol-1-yl)benzamide |
| SMILES | COc1ccc(CN2CCC(NC(=O)c3ccc(-n4nccc4C)cc3)CC2)cc1F |
| InChI | InChI=1S/C24H27FN4O2/c1-17-9-12-26-29(17)21-6-4-19(5-7-21)24(30)27-20-10-13-28(14-11-20)16-18-3-8-23(31-2)22(25)15-18/h3-9,12,15,20H,10-11,13-14,16H2,1-2H3,(H,27,30) |
| InChIKey | IWVFEIHHMCMRKY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |