C25H31FN2O4 — CID 55959144
N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 55959144) has the molecular formula C25H31FN2O4 and a molecular weight of 442.53 g/mol. Its IUPAC name is N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55959144 |
| Molecular Formula | C25H31FN2O4 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | COc1ccc(CN2CCC(NC(=O)c3ccc(OCC4CCCO4)cc3)CC2)cc1F |
| InChI | InChI=1S/C25H31FN2O4/c1-30-24-9-4-18(15-23(24)26)16-28-12-10-20(11-13-28)27-25(29)19-5-7-21(8-6-19)32-17-22-3-2-14-31-22/h4-9,15,20,22H,2-3,10-14,16-17H2,1H3,(H,27,29) |
| InChIKey | QAMMOBIOEQTLDC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |