C13H14F2N2O2 — CID 43652927
1-(2,4-difluorophenyl)-3-(4-oxocyclohexyl)urea (PubChem CID 43652927) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-oxocyclohexyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-oxocyclohexyl)urea |
|---|---|
| PubChem CID | 43652927 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-oxocyclohexyl)urea |
| SMILES | O=C1CCC(NC(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H14F2N2O2/c14-8-1-6-12(11(15)7-8)17-13(19)16-9-2-4-10(18)5-3-9/h1,6-7,9H,2-5H2,(H2,16,17,19) |
| InChIKey | YWAPBGGTHWLANX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |