C17H23F2N3O2 — CID 127228015
1-(2,4-difluorophenyl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea (PubChem CID 127228015) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 127228015 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
| SMILES | CC(C)CC(=O)N1CCC(NC(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-11(2)9-16(23)22-7-5-13(6-8-22)20-17(24)21-15-4-3-12(18)10-14(15)19/h3-4,10-11,13H,5-9H2,1-2H3,(H2,20,21,24) |
| InChIKey | OXNJSOWUTIQPAF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |