C15H21FN4O2 — CID 119734443
1-(4-fluorophenyl)-3-[1-[2-(methylamino)acetyl]piperidin-4-yl]urea (PubChem CID 119734443) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[1-[2-(methylamino)acetyl]piperidin-4-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[1-[2-(methylamino)acetyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 119734443 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[1-[2-(methylamino)acetyl]piperidin-4-yl]urea |
| SMILES | CNCC(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H21FN4O2/c1-17-10-14(21)20-8-6-13(7-9-20)19-15(22)18-12-4-2-11(16)3-5-12/h2-5,13,17H,6-10H2,1H3,(H2,18,19,22) |
| InChIKey | VUWZNFOLUSGZBT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |