C21H25FN4O2 — CID 120609351
1-[1-[3-(2-aminophenyl)propanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea (PubChem CID 120609351) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[1-[3-(2-aminophenyl)propanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-[3-(2-aminophenyl)propanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 120609351 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[1-[3-(2-aminophenyl)propanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea |
| SMILES | Nc1ccccc1CCC(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25FN4O2/c22-16-6-8-17(9-7-16)24-21(28)25-18-11-13-26(14-12-18)20(27)10-5-15-3-1-2-4-19(15)23/h1-4,6-9,18H,5,10-14,23H2,(H2,24,25,28) |
| InChIKey | MLXNGTIPPXHUAY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|