C20H23ClFN3O2 — CID 120608667
3-(2-aminophenyl)-1-[4-(4-fluorobenzoyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 120608667) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[4-(4-fluorobenzoyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-[4-(4-fluorobenzoyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120608667 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-(2-aminophenyl)-1-[4-(4-fluorobenzoyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCC(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN3O2.ClH/c21-17-8-5-16(6-9-17)20(26)24-13-11-23(12-14-24)19(25)10-7-15-3-1-2-4-18(15)22;/h1-6,8-9H,7,10-14,22H2;1H |
| InChIKey | SBNZEIGFTYVSJW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|