C20H32Cl2N4O2 — CID 120612307
3-(2-aminophenyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-diazepan-1-yl]propan-1-one;dihydrochloride (PubChem CID 120612307) has the molecular formula C20H32Cl2N4O2 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-diazepan-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-diazepan-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120612307 |
| Molecular Formula | C20H32Cl2N4O2 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-(2-aminophenyl)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-diazepan-1-yl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1CCC(=O)N1CCCN(CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H30N4O2.2ClH/c21-18-7-2-1-6-17(18)8-9-19(25)24-13-5-10-22(14-15-24)16-20(26)23-11-3-4-12-23;;/h1-2,6-7H,3-5,8-16,21H2;2*1H |
| InChIKey | XGQNJRMHOKCUGO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|