C18H28N2O — CID 63162343
3-(2-aminophenyl)-1-(4,4-diethylpiperidin-1-yl)propan-1-one (PubChem CID 63162343) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-(4,4-diethylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-(2-aminophenyl)-1-(4,4-diethylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 63162343 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-(2-aminophenyl)-1-(4,4-diethylpiperidin-1-yl)propan-1-one |
| SMILES | CCC1(CC)CCN(C(=O)CCc2ccccc2N)CC1 |
| InChI | InChI=1S/C18H28N2O/c1-3-18(4-2)11-13-20(14-12-18)17(21)10-9-15-7-5-6-8-16(15)19/h5-8H,3-4,9-14,19H2,1-2H3 |
| InChIKey | LJAZFAURMSPGGY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|