C14H18ClF3N2O2 — CID 120611230
3-(2-aminophenyl)-1-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride (PubChem CID 120611230) has the molecular formula C14H18ClF3N2O2 and a molecular weight of 338.76 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120611230 |
| Molecular Formula | C14H18ClF3N2O2 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-(2-aminophenyl)-1-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCC(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F3N2O2.ClH/c15-14(16,17)13(21)7-8-19(9-13)12(20)6-5-10-3-1-2-4-11(10)18;/h1-4,21H,5-9,18H2;1H |
| InChIKey | OHNAYXNJIXWFQC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|