C17H20F3NO2 — CID 124873581
1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone (PubChem CID 124873581) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone.
| Compound Name | 1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone |
|---|---|
| PubChem CID | 124873581 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(3-phenylcyclobutyl)ethanone |
| SMILES | O=C(CC1CC(c2ccccc2)C1)N1CC[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F3NO2/c18-17(19,20)16(23)6-7-21(11-16)15(22)10-12-8-14(9-12)13-4-2-1-3-5-13/h1-5,12,14,23H,6-11H2/t12?,14?,16-/m1/s1 |
| InChIKey | CRTZVMXEUXSTJY-LDZOIKDWSA-N |
| XLogP | 3.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |