C11H18F3NO4S — CID 99698290
2-tert-butylsulfonyl-1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]ethanone (PubChem CID 99698290) has the molecular formula C11H18F3NO4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-tert-butylsulfonyl-1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99698290 |
| Molecular Formula | C11H18F3NO4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-tert-butylsulfonyl-1-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(C)(C)S(=O)(=O)CC(=O)N1CC[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H18F3NO4S/c1-9(2,3)20(18,19)6-8(16)15-5-4-10(17,7-15)11(12,13)14/h17H,4-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | WKXPQAQNBNLDIO-SNVBAGLBSA-N |
| XLogP | 0.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |