C6H10F3N3O2 — CID 130524196
3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carbohydrazide (PubChem CID 130524196) has the molecular formula C6H10F3N3O2 and a molecular weight of 213.16 g/mol. Its IUPAC name is 3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carbohydrazide.
| Compound Name | 3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carbohydrazide |
|---|---|
| PubChem CID | 130524196 |
| Molecular Formula | C6H10F3N3O2 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carbohydrazide |
| SMILES | NNC(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3N3O2/c7-6(8,9)5(14)1-2-12(3-5)4(13)11-10/h14H,1-3,10H2,(H,11,13) |
| InChIKey | NBYOCIBKESETGR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|