C6H11F2N3O — CID 116991543
3,3-difluoropiperidine-1-carbohydrazide (PubChem CID 116991543) has the molecular formula C6H11F2N3O and a molecular weight of 179.17 g/mol. Its IUPAC name is 3,3-difluoropiperidine-1-carbohydrazide.
| Compound Name | 3,3-difluoropiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 116991543 |
| Molecular Formula | C6H11F2N3O |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3,3-difluoropiperidine-1-carbohydrazide |
| SMILES | NNC(=O)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C6H11F2N3O/c7-6(8)2-1-3-11(4-6)5(12)10-9/h1-4,9H2,(H,10,12) |
| InChIKey | PSKPSCDRZAOFDR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|