C8H17N3O2 — CID 107405919
4-hydroxy-4-methylazepane-1-carbohydrazide (PubChem CID 107405919) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-hydroxy-4-methylazepane-1-carbohydrazide.
| Compound Name | 4-hydroxy-4-methylazepane-1-carbohydrazide |
|---|---|
| PubChem CID | 107405919 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 4-hydroxy-4-methylazepane-1-carbohydrazide |
| SMILES | CC1(O)CCCN(C(=O)NN)CC1 |
| InChI | InChI=1S/C8H17N3O2/c1-8(13)3-2-5-11(6-4-8)7(12)10-9/h13H,2-6,9H2,1H3,(H,10,12) |
| InChIKey | GUTSZIIUXNOYJD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|