C12H22N2O4 — CID 107405958
ethyl 2-[(4-hydroxy-4-methylazepane-1-carbonyl)amino]acetate (PubChem CID 107405958) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is ethyl 2-[(4-hydroxy-4-methylazepane-1-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(4-hydroxy-4-methylazepane-1-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 107405958 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | ethyl 2-[(4-hydroxy-4-methylazepane-1-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCCC(C)(O)CC1 |
| InChI | InChI=1S/C12H22N2O4/c1-3-18-10(15)9-13-11(16)14-7-4-5-12(2,17)6-8-14/h17H,3-9H2,1-2H3,(H,13,16) |
| InChIKey | VANYGYMJVHXQNZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |