C10H18F2N2O — CID 116991427
4-amino-1-(3,3-difluoropiperidin-1-yl)pentan-1-one (PubChem CID 116991427) has the molecular formula C10H18F2N2O and a molecular weight of 220.26 g/mol. Its IUPAC name is 4-amino-1-(3,3-difluoropiperidin-1-yl)pentan-1-one.
| Compound Name | 4-amino-1-(3,3-difluoropiperidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 116991427 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4-amino-1-(3,3-difluoropiperidin-1-yl)pentan-1-one |
| SMILES | CC(N)CCC(=O)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2O/c1-8(13)3-4-9(15)14-6-2-5-10(11,12)7-14/h8H,2-7,13H2,1H3 |
| InChIKey | IEGWOFKRMAGXAI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |