C16H32N4O2 — CID 120564514
2-[4-(4-aminopentanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide (PubChem CID 120564514) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-[4-(4-aminopentanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(4-aminopentanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 120564514 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-[4-(4-aminopentanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)CCC(C)N)CC1 |
| InChI | InChI=1S/C16H32N4O2/c1-4-19(5-2)16(22)13-18-9-6-10-20(12-11-18)15(21)8-7-14(3)17/h14H,4-13,17H2,1-3H3 |
| InChIKey | YTPIWBMURPTONW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |