C15H32Cl2N4O2 — CID 120565339
4-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]pentan-1-one;dihydrochloride (PubChem CID 120565339) has the molecular formula C15H32Cl2N4O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]pentan-1-one;dihydrochloride.
| Compound Name | 4-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]pentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120565339 |
| Molecular Formula | C15H32Cl2N4O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]pentan-1-one;dihydrochloride |
| SMILES | CCN(CC)CC(=O)N1CCN(C(=O)CCC(C)N)CC1.Cl.Cl |
| InChI | InChI=1S/C15H30N4O2.2ClH/c1-4-17(5-2)12-15(21)19-10-8-18(9-11-19)14(20)7-6-13(3)16;;/h13H,4-12,16H2,1-3H3;2*1H |
| InChIKey | QBFMPJTTXRPHQE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |