C14H29N5O3S — CID 120560567
4-amino-1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 120560567) has the molecular formula C14H29N5O3S and a molecular weight of 347.49 g/mol. Its IUPAC name is 4-amino-1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 4-amino-1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 120560567 |
| Molecular Formula | C14H29N5O3S |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 4-amino-1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | CC(N)CCC(=O)N1CCN(S(=O)(=O)N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C14H29N5O3S/c1-13(15)3-4-14(20)17-7-11-19(12-8-17)23(21,22)18-9-5-16(2)6-10-18/h13H,3-12,15H2,1-2H3 |
| InChIKey | WIHUEFBOJQMXPT-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |