C13H28Cl2N4O2 — CID 120564659
4-amino-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]pentanamide;dihydrochloride (PubChem CID 120564659) has the molecular formula C13H28Cl2N4O2 and a molecular weight of 343.30 g/mol. Its IUPAC name is 4-amino-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564659 |
| Molecular Formula | C13H28Cl2N4O2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-amino-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCCC(=O)N1CCN(C)CC1.Cl.Cl |
| InChI | InChI=1S/C13H26N4O2.2ClH/c1-11(14)3-4-12(18)15-6-5-13(19)17-9-7-16(2)8-10-17;;/h11H,3-10,14H2,1-2H3,(H,15,18);2*1H |
| InChIKey | UASPGSZQPANAQZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |