C8H16N4O2 — CID 127518835
[2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea (PubChem CID 127518835) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea.
| Compound Name | [2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 127518835 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-2-oxoethyl]urea |
| SMILES | CN1CCN(C(=O)CNC(N)=O)CC1 |
| InChI | InChI=1S/C8H16N4O2/c1-11-2-4-12(5-3-11)7(13)6-10-8(9)14/h2-6H2,1H3,(H3,9,10,14) |
| InChIKey | BMDBTWIRIFNKEL-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |