C8H13N3O2 — CID 130608897
[2-(3,6-dihydro-2H-pyridin-1-yl)-2-oxoethyl]urea (PubChem CID 130608897) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is [2-(3,6-dihydro-2H-pyridin-1-yl)-2-oxoethyl]urea.
| Compound Name | [2-(3,6-dihydro-2H-pyridin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 130608897 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | [2-(3,6-dihydro-2H-pyridin-1-yl)-2-oxoethyl]urea |
| SMILES | NC(=O)NCC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C8H13N3O2/c9-8(13)10-6-7(12)11-4-2-1-3-5-11/h1-2H,3-6H2,(H3,9,10,13) |
| InChIKey | VPSHMSUPEQUCSD-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|