C9H16N2O — CID 13141783
N-propyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 13141783) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-propyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-propyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 13141783 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-propyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CCCNC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C9H16N2O/c1-2-6-10-9(12)11-7-4-3-5-8-11/h3-4H,2,5-8H2,1H3,(H,10,12) |
| InChIKey | MOLLVIKXVXKVBH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|