C10H18N2O — CID 3824227
N-pentyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 3824227) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-pentyl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | N-pentyl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 3824227 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-pentyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CCCCCNC(=O)N1CC=CC1 |
| InChI | InChI=1S/C10H18N2O/c1-2-3-4-7-11-10(13)12-8-5-6-9-12/h5-6H,2-4,7-9H2,1H3,(H,11,13) |
| InChIKey | KKICRKLNVCYKTN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|