C19H38N4O2 — CID 27255411
(2S)-1-N,4-N-dihexyl-2-methylpiperazine-1,4-dicarboxamide (PubChem CID 27255411) has the molecular formula C19H38N4O2 and a molecular weight of 354.54 g/mol. Its IUPAC name is (2S)-1-N,4-N-dihexyl-2-methylpiperazine-1,4-dicarboxamide.
| Compound Name | (2S)-1-N,4-N-dihexyl-2-methylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 27255411 |
| Molecular Formula | C19H38N4O2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (2S)-1-N,4-N-dihexyl-2-methylpiperazine-1,4-dicarboxamide |
| SMILES | CCCCCCNC(=O)N1CCN(C(=O)NCCCCCC)[C@@H](C)C1 |
| InChI | InChI=1S/C19H38N4O2/c1-4-6-8-10-12-20-18(24)22-14-15-23(17(3)16-22)19(25)21-13-11-9-7-5-2/h17H,4-16H2,1-3H3,(H,20,24)(H,21,25)/t17-/m0/s1 |
| InChIKey | SAVIHLYIANNRGW-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|