C19H37N5O3 — CID 42710406
N-butyl-4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methylpiperazine-1-carboxamide (PubChem CID 42710406) has the molecular formula C19H37N5O3 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-butyl-4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methylpiperazine-1-carboxamide.
| Compound Name | N-butyl-4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42710406 |
| Molecular Formula | C19H37N5O3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | N-butyl-4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(=O)C(NC(=O)NCC)C(C)CC)CC1C |
| InChI | InChI=1S/C19H37N5O3/c1-6-9-10-21-19(27)24-12-11-23(13-15(24)5)17(25)16(14(4)7-2)22-18(26)20-8-3/h14-16H,6-13H2,1-5H3,(H,21,27)(H2,20,22,26) |
| InChIKey | QLBDQXMAXGDKTD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|