C21H33N5O3 — CID 42710442
4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methyl-N-phenylpiperazine-1-carboxamide (PubChem CID 42710442) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methyl-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methyl-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42710442 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 4-[2-(ethylcarbamoylamino)-3-methylpentanoyl]-2-methyl-N-phenylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)NC(C(=O)N1CCN(C(=O)Nc2ccccc2)C(C)C1)C(C)CC |
| InChI | InChI=1S/C21H33N5O3/c1-5-15(3)18(24-20(28)22-6-2)19(27)25-12-13-26(16(4)14-25)21(29)23-17-10-8-7-9-11-17/h7-11,15-16,18H,5-6,12-14H2,1-4H3,(H,23,29)(H2,22,24,28) |
| InChIKey | HENKTZGONHLBGX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |