C18H27ClN4O2 — CID 42695544
4-(2-amino-3-methylpentanoyl)-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide (PubChem CID 42695544) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-(2-amino-3-methylpentanoyl)-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide.
| Compound Name | 4-(2-amino-3-methylpentanoyl)-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42695544 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-(2-amino-3-methylpentanoyl)-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide |
| SMILES | CCC(C)C(N)C(=O)N1CCN(C(=O)Nc2cccc(Cl)c2)C(C)C1 |
| InChI | InChI=1S/C18H27ClN4O2/c1-4-12(2)16(20)17(24)22-8-9-23(13(3)11-22)18(25)21-15-7-5-6-14(19)10-15/h5-7,10,12-13,16H,4,8-9,11,20H2,1-3H3,(H,21,25) |
| InChIKey | CUWLWUIQIUMWGX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |