C19H20Cl2N4O2 — CID 4052686
1-N,4-N-bis(4-chlorophenyl)-2-methylpiperazine-1,4-dicarboxamide (PubChem CID 4052686) has the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.30 g/mol. Its IUPAC name is 1-N,4-N-bis(4-chlorophenyl)-2-methylpiperazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-chlorophenyl)-2-methylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4052686 |
| Molecular Formula | C19H20Cl2N4O2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-N,4-N-bis(4-chlorophenyl)-2-methylpiperazine-1,4-dicarboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(Cl)cc2)CCN1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2N4O2/c1-13-12-24(18(26)22-16-6-2-14(20)3-7-16)10-11-25(13)19(27)23-17-8-4-15(21)5-9-17/h2-9,13H,10-12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | NWQBJXKJPCWMKA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |