C14H19ClN2O3 — CID 143206932
N-(4-chlorophenyl)-3-methylpiperidine-1-carboxamide;formic acid (PubChem CID 143206932) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-methylpiperidine-1-carboxamide;formic acid.
| Compound Name | N-(4-chlorophenyl)-3-methylpiperidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 143206932 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(4-chlorophenyl)-3-methylpiperidine-1-carboxamide;formic acid |
| SMILES | CC1CCCN(C(=O)Nc2ccc(Cl)cc2)C1.O=CO |
| InChI | InChI=1S/C13H17ClN2O.CH2O2/c1-10-3-2-8-16(9-10)13(17)15-12-6-4-11(14)5-7-12;2-1-3/h4-7,10H,2-3,8-9H2,1H3,(H,15,17);1H,(H,2,3) |
| InChIKey | IEDOVJUKVBGVGT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|