C14H16ClN3O — CID 47197271
N-(3-chloro-4-cyanophenyl)-3-methylpiperidine-1-carboxamide (PubChem CID 47197271) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 47197271 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)Nc2ccc(C#N)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H16ClN3O/c1-10-3-2-6-18(9-10)14(19)17-12-5-4-11(8-16)13(15)7-12/h4-5,7,10H,2-3,6,9H2,1H3,(H,17,19) |
| InChIKey | LZBHKLFPWLTSJI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |