C15H19ClN2O2 — CID 108952332
N-(4-chlorophenyl)-3-(3-methylpiperidin-1-yl)-3-oxopropanamide (PubChem CID 108952332) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-(3-methylpiperidin-1-yl)-3-oxopropanamide.
| Compound Name | N-(4-chlorophenyl)-3-(3-methylpiperidin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108952332 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-(4-chlorophenyl)-3-(3-methylpiperidin-1-yl)-3-oxopropanamide |
| SMILES | CC1CCCN(C(=O)CC(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-11-3-2-8-18(10-11)15(20)9-14(19)17-13-6-4-12(16)5-7-13/h4-7,11H,2-3,8-10H2,1H3,(H,17,19) |
| InChIKey | INTQVPVQFBVIBU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|