C13H19Cl2N3O — CID 165430478
N-(4-chlorophenyl)-4-(methylamino)piperidine-1-carboxamide;hydrochloride (PubChem CID 165430478) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(methylamino)piperidine-1-carboxamide;hydrochloride.
| Compound Name | N-(4-chlorophenyl)-4-(methylamino)piperidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 165430478 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-(4-chlorophenyl)-4-(methylamino)piperidine-1-carboxamide;hydrochloride |
| SMILES | CNC1CCN(C(=O)Nc2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C13H18ClN3O.ClH/c1-15-11-6-8-17(9-7-11)13(18)16-12-4-2-10(14)3-5-12;/h2-5,11,15H,6-9H2,1H3,(H,16,18);1H |
| InChIKey | QDTWLCDOAKWTNL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |