C26H24ClN3O3 — CID 46530497
4-[[2-(4-chlorobenzoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide (PubChem CID 46530497) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 4-[[2-(4-chlorobenzoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[[2-(4-chlorobenzoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46530497 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 4-[[2-(4-chlorobenzoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2ccccc2)CC1)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN3O3/c27-19-12-10-18(11-13-19)24(31)22-8-4-5-9-23(22)25(32)28-21-14-16-30(17-15-21)26(33)29-20-6-2-1-3-7-20/h1-13,21H,14-17H2,(H,28,32)(H,29,33) |
| InChIKey | NORHSJWOGBGVOD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |