C21H22ClNO2 — CID 11841438
2-(4-chlorobenzoyl)-N-cycloheptylbenzamide (PubChem CID 11841438) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)-N-cycloheptylbenzamide.
| Compound Name | 2-(4-chlorobenzoyl)-N-cycloheptylbenzamide |
|---|---|
| PubChem CID | 11841438 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-(4-chlorobenzoyl)-N-cycloheptylbenzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO2/c22-16-13-11-15(12-14-16)20(24)18-9-5-6-10-19(18)21(25)23-17-7-3-1-2-4-8-17/h5-6,9-14,17H,1-4,7-8H2,(H,23,25) |
| InChIKey | YSIOIISYCWPRRZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |