C25H30Cl2N4O3 — CID 46115899
4-[2-(4-chlorobutanoylamino)-3-phenylpropanoyl]-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide (PubChem CID 46115899) has the molecular formula C25H30Cl2N4O3 and a molecular weight of 505.45 g/mol. Its IUPAC name is 4-[2-(4-chlorobutanoylamino)-3-phenylpropanoyl]-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(4-chlorobutanoylamino)-3-phenylpropanoyl]-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 46115899 |
| Molecular Formula | C25H30Cl2N4O3 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 4-[2-(4-chlorobutanoylamino)-3-phenylpropanoyl]-N-(3-chlorophenyl)-2-methylpiperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)C(Cc2ccccc2)NC(=O)CCCCl)CCN1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30Cl2N4O3/c1-18-17-30(13-14-31(18)25(34)28-21-10-5-9-20(27)16-21)24(33)22(29-23(32)11-6-12-26)15-19-7-3-2-4-8-19/h2-5,7-10,16,18,22H,6,11-15,17H2,1H3,(H,28,34)(H,29,32) |
| InChIKey | REEGHGZUVDNFLQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|