C26H34N4O3 — CID 42707549
4-(2-benzamido-3-phenylpropanoyl)-N-butyl-2-methylpiperazine-1-carboxamide (PubChem CID 42707549) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 4-(2-benzamido-3-phenylpropanoyl)-N-butyl-2-methylpiperazine-1-carboxamide.
| Compound Name | 4-(2-benzamido-3-phenylpropanoyl)-N-butyl-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42707549 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 4-(2-benzamido-3-phenylpropanoyl)-N-butyl-2-methylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)CC1C |
| InChI | InChI=1S/C26H34N4O3/c1-3-4-15-27-26(33)30-17-16-29(19-20(30)2)25(32)23(18-21-11-7-5-8-12-21)28-24(31)22-13-9-6-10-14-22/h5-14,20,23H,3-4,15-19H2,1-2H3,(H,27,33)(H,28,31) |
| InChIKey | LYDDNNCCMYXFPG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|