C23H35N5O5 — CID 42724930
N-butyl-2-methyl-4-[3-methyl-2-[(3-nitrobenzoyl)amino]pentanoyl]piperazine-1-carboxamide (PubChem CID 42724930) has the molecular formula C23H35N5O5 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-butyl-2-methyl-4-[3-methyl-2-[(3-nitrobenzoyl)amino]pentanoyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-2-methyl-4-[3-methyl-2-[(3-nitrobenzoyl)amino]pentanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42724930 |
| Molecular Formula | C23H35N5O5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N-butyl-2-methyl-4-[3-methyl-2-[(3-nitrobenzoyl)amino]pentanoyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(=O)C(NC(=O)c2cccc([N+](=O)[O-])c2)C(C)CC)CC1C |
| InChI | InChI=1S/C23H35N5O5/c1-5-7-11-24-23(31)27-13-12-26(15-17(27)4)22(30)20(16(3)6-2)25-21(29)18-9-8-10-19(14-18)28(32)33/h8-10,14,16-17,20H,5-7,11-13,15H2,1-4H3,(H,24,31)(H,25,29) |
| InChIKey | SZFKWWIBOSRDKZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|