C29H41N3O3 — CID 42707667
N-[3-methyl-1-[3-methyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]-1-oxopentan-2-yl]heptanamide (PubChem CID 42707667) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is N-[3-methyl-1-[3-methyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]-1-oxopentan-2-yl]heptanamide.
| Compound Name | N-[3-methyl-1-[3-methyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]-1-oxopentan-2-yl]heptanamide |
|---|---|
| PubChem CID | 42707667 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N-[3-methyl-1-[3-methyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]-1-oxopentan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC(C(=O)N1CCN(C(=O)c2cccc3ccccc23)C(C)C1)C(C)CC |
| InChI | InChI=1S/C29H41N3O3/c1-5-7-8-9-17-26(33)30-27(21(3)6-2)29(35)31-18-19-32(22(4)20-31)28(34)25-16-12-14-23-13-10-11-15-24(23)25/h10-16,21-22,27H,5-9,17-20H2,1-4H3,(H,30,33) |
| InChIKey | GWALVNUIOQJJRI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|