C21H38ClN3O3 — CID 4316747
2-chloro-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxopentan-2-yl]acetamide (PubChem CID 4316747) has the molecular formula C21H38ClN3O3 and a molecular weight of 416.01 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxopentan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 4316747 |
| Molecular Formula | C21H38ClN3O3 |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxopentan-2-yl]acetamide |
| SMILES | CCCCCCCC(=O)N1CCN(C(=O)C(NC(=O)CCl)C(C)CC)CC1C |
| InChI | InChI=1S/C21H38ClN3O3/c1-5-7-8-9-10-11-19(27)25-13-12-24(15-17(25)4)21(28)20(16(3)6-2)23-18(26)14-22/h16-17,20H,5-15H2,1-4H3,(H,23,26) |
| InChIKey | DIKZIOYLHZWZLX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|