C20H35N3O3 — CID 42706572
N-[1-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]hexanamide (PubChem CID 42706572) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[1-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]hexanamide.
| Compound Name | N-[1-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 42706572 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | N-[1-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)NC(C(=O)N1CCN(C(=O)C2CC2)C(C)C1)C(C)C |
| InChI | InChI=1S/C20H35N3O3/c1-5-6-7-8-17(24)21-18(14(2)3)20(26)22-11-12-23(15(4)13-22)19(25)16-9-10-16/h14-16,18H,5-13H2,1-4H3,(H,21,24) |
| InChIKey | VTOJIBGGIGVBRS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|