C21H40N4O3 — CID 42708174
N-ethyl-2-methyl-4-[3-methyl-2-(octanoylamino)butanoyl]piperazine-1-carboxamide (PubChem CID 42708174) has the molecular formula C21H40N4O3 and a molecular weight of 396.58 g/mol. Its IUPAC name is N-ethyl-2-methyl-4-[3-methyl-2-(octanoylamino)butanoyl]piperazine-1-carboxamide.
| Compound Name | N-ethyl-2-methyl-4-[3-methyl-2-(octanoylamino)butanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42708174 |
| Molecular Formula | C21H40N4O3 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | N-ethyl-2-methyl-4-[3-methyl-2-(octanoylamino)butanoyl]piperazine-1-carboxamide |
| SMILES | CCCCCCCC(=O)NC(C(=O)N1CCN(C(=O)NCC)C(C)C1)C(C)C |
| InChI | InChI=1S/C21H40N4O3/c1-6-8-9-10-11-12-18(26)23-19(16(3)4)20(27)24-13-14-25(17(5)15-24)21(28)22-7-2/h16-17,19H,6-15H2,1-5H3,(H,22,28)(H,23,26) |
| InChIKey | XVUMGIQKIRECMM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|