C26H42N4O3 — CID 4240009
1-benzyl-3-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]urea (PubChem CID 4240009) has the molecular formula C26H42N4O3 and a molecular weight of 458.65 g/mol. Its IUPAC name is 1-benzyl-3-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]urea.
| Compound Name | 1-benzyl-3-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 4240009 |
| Molecular Formula | C26H42N4O3 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | 1-benzyl-3-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]urea |
| SMILES | CCCCCCCC(=O)N1CCN(C(=O)C(NC(=O)NCc2ccccc2)C(C)C)CC1C |
| InChI | InChI=1S/C26H42N4O3/c1-5-6-7-8-12-15-23(31)30-17-16-29(19-21(30)4)25(32)24(20(2)3)28-26(33)27-18-22-13-10-9-11-14-22/h9-11,13-14,20-21,24H,5-8,12,15-19H2,1-4H3,(H2,27,28,33) |
| InChIKey | GKCBSTNIZYKERQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|