C26H35N5O3 — CID 55543585
N-benzyl-2-[4-[2-(benzylcarbamoylamino)-3-methylbutanoyl]piperazin-1-yl]acetamide (PubChem CID 55543585) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-benzyl-2-[4-[2-(benzylcarbamoylamino)-3-methylbutanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[2-(benzylcarbamoylamino)-3-methylbutanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55543585 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | N-benzyl-2-[4-[2-(benzylcarbamoylamino)-3-methylbutanoyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)C(NC(=O)NCc1ccccc1)C(=O)N1CCN(CC(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N5O3/c1-20(2)24(29-26(34)28-18-22-11-7-4-8-12-22)25(33)31-15-13-30(14-16-31)19-23(32)27-17-21-9-5-3-6-10-21/h3-12,20,24H,13-19H2,1-2H3,(H,27,32)(H2,28,29,34) |
| InChIKey | GRUCMQUJEKZQLZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |