C21H36N4O3 — CID 163526789
N-benzyl-2-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]acetamide (PubChem CID 163526789) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-benzyl-2-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]acetamide |
|---|---|
| PubChem CID | 163526789 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N-benzyl-2-[4,7-bis(2-hydroxypropyl)-1,4,7-triazonan-1-yl]acetamide |
| SMILES | CC(O)CN1CCN(CC(=O)NCc2ccccc2)CCN(CC(C)O)CC1 |
| InChI | InChI=1S/C21H36N4O3/c1-18(26)15-23-8-9-24(16-19(2)27)11-13-25(12-10-23)17-21(28)22-14-20-6-4-3-5-7-20/h3-7,18-19,26-27H,8-17H2,1-2H3,(H,22,28) |
| InChIKey | DPLVKXJYIGKFDM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |