C29H34N4O2 — CID 24596362
N-benzyl-2-[4-[2-(1,2-diphenylethylamino)-2-oxoethyl]piperazin-1-yl]acetamide (PubChem CID 24596362) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-benzyl-2-[4-[2-(1,2-diphenylethylamino)-2-oxoethyl]piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[2-(1,2-diphenylethylamino)-2-oxoethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24596362 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-benzyl-2-[4-[2-(1,2-diphenylethylamino)-2-oxoethyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CC(=O)NC(Cc2ccccc2)c2ccccc2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C29H34N4O2/c34-28(30-21-25-12-6-2-7-13-25)22-32-16-18-33(19-17-32)23-29(35)31-27(26-14-8-3-9-15-26)20-24-10-4-1-5-11-24/h1-15,27H,16-23H2,(H,30,34)(H,31,35) |
| InChIKey | JFIUVQMQCQSQGM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |